C14H32O7Si2 — CID 174508197
ethenyl(trimethoxy)silane;1,1,2,2-tetramethoxysilinane (PubChem CID 174508197) has the molecular formula C14H32O7Si2 and a molecular weight of 368.58 g/mol. Its IUPAC name is ethenyl(trimethoxy)silane;1,1,2,2-tetramethoxysilinane.
| Compound Name | ethenyl(trimethoxy)silane;1,1,2,2-tetramethoxysilinane |
|---|---|
| PubChem CID | 174508197 |
| Molecular Formula | C14H32O7Si2 |
| Molecular Weight | 368.58 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | ethenyl(trimethoxy)silane;1,1,2,2-tetramethoxysilinane |
| SMILES | C=C[Si](OC)(OC)OC.COC1(OC)CCCC[Si]1(OC)OC |
| InChI | InChI=1S/C9H20O4Si.C5H12O3Si/c1-10-9(11-2)7-5-6-8-14(9,12-3)13-4;1-5-9(6-2,7-3)8-4/h5-8H2,1-4H3;5H,1H2,2-4H3 |
| InChIKey | NYVZFIVOYFIDIQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.58 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|