C13H24O4Si — CID 174838425
3,3-bis(ethenyl)-1,1,2,2-tetramethoxysilinane (PubChem CID 174838425) has the molecular formula C13H24O4Si and a molecular weight of 272.42 g/mol. Its IUPAC name is 3,3-bis(ethenyl)-1,1,2,2-tetramethoxysilinane.
| Compound Name | 3,3-bis(ethenyl)-1,1,2,2-tetramethoxysilinane |
|---|---|
| PubChem CID | 174838425 |
| Molecular Formula | C13H24O4Si |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 3,3-bis(ethenyl)-1,1,2,2-tetramethoxysilinane |
| SMILES | C=CC1(C=C)CCC[Si](OC)(OC)C1(OC)OC |
| InChI | InChI=1S/C13H24O4Si/c1-7-12(8-2)10-9-11-18(16-5,17-6)13(12,14-3)15-4/h7-8H,1-2,9-11H2,3-6H3 |
| InChIKey | RYGCGBUDBYCANH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|