C17H33NO7Si — CID 174819830
3-carbamoyl-3-hydroxy-4-methylpentanoic acid;2-ethenyl-1,1,2-trimethoxysilinane (PubChem CID 174819830) has the molecular formula C17H33NO7Si and a molecular weight of 391.54 g/mol. Its IUPAC name is 3-carbamoyl-3-hydroxy-4-methylpentanoic acid;2-ethenyl-1,1,2-trimethoxysilinane.
| Compound Name | 3-carbamoyl-3-hydroxy-4-methylpentanoic acid;2-ethenyl-1,1,2-trimethoxysilinane |
|---|---|
| PubChem CID | 174819830 |
| Molecular Formula | C17H33NO7Si |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 3-carbamoyl-3-hydroxy-4-methylpentanoic acid;2-ethenyl-1,1,2-trimethoxysilinane |
| SMILES | C=CC1(OC)CCCC[Si]1(OC)OC.CC(C)C(O)(CC(=O)O)C(N)=O |
| InChI | InChI=1S/C10H20O3Si.C7H13NO4/c1-5-10(11-2)8-6-7-9-14(10,12-3)13-4;1-4(2)7(12,6(8)11)3-5(9)10/h5H,1,6-9H2,2-4H3;4,12H,3H2,1-2H3,(H2,8,11)(H,9,10) |
| InChIKey | SSPWPJHEWPVPSM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|