C15H28O4Si — CID 174647401
1-(1,1,2-trimethoxy-3-methyl-2-propylsilinan-3-yl)prop-2-en-1-one (PubChem CID 174647401) has the molecular formula C15H28O4Si and a molecular weight of 300.47 g/mol. Its IUPAC name is 1-(1,1,2-trimethoxy-3-methyl-2-propylsilinan-3-yl)prop-2-en-1-one.
| Compound Name | 1-(1,1,2-trimethoxy-3-methyl-2-propylsilinan-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 174647401 |
| Molecular Formula | C15H28O4Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 1-(1,1,2-trimethoxy-3-methyl-2-propylsilinan-3-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)C1(C)CCC[Si](OC)(OC)C1(CCC)OC |
| InChI | InChI=1S/C15H28O4Si/c1-7-10-15(17-4)14(3,13(16)8-2)11-9-12-20(15,18-5)19-6/h8H,2,7,9-12H2,1,3-6H3 |
| InChIKey | ATHCVQAEQJJNOI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|