C13H30N2O3Si — CID 174973430
3-N-ethyl-1,1,2-trimethoxy-3-propylsilinane-2,3-diamine (PubChem CID 174973430) has the molecular formula C13H30N2O3Si and a molecular weight of 290.48 g/mol. Its IUPAC name is 3-N-ethyl-1,1,2-trimethoxy-3-propylsilinane-2,3-diamine.
| Compound Name | 3-N-ethyl-1,1,2-trimethoxy-3-propylsilinane-2,3-diamine |
|---|---|
| PubChem CID | 174973430 |
| Molecular Formula | C13H30N2O3Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 3-N-ethyl-1,1,2-trimethoxy-3-propylsilinane-2,3-diamine |
| SMILES | CCCC1(NCC)CCC[Si](OC)(OC)C1(N)OC |
| InChI | InChI=1S/C13H30N2O3Si/c1-6-9-12(15-7-2)10-8-11-19(17-4,18-5)13(12,14)16-3/h15H,6-11,14H2,1-5H3 |
| InChIKey | OWNJZSAPTWFIBL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|