C15H35N3O3Si — CID 174427736
3-N'-(1-aminoethyl)-3-N-ethyl-1,1,2-trimethoxy-2-propylsilinane-3,3-diamine (PubChem CID 174427736) has the molecular formula C15H35N3O3Si and a molecular weight of 333.55 g/mol. Its IUPAC name is 3-N'-(1-aminoethyl)-3-N-ethyl-1,1,2-trimethoxy-2-propylsilinane-3,3-diamine.
| Compound Name | 3-N'-(1-aminoethyl)-3-N-ethyl-1,1,2-trimethoxy-2-propylsilinane-3,3-diamine |
|---|---|
| PubChem CID | 174427736 |
| Molecular Formula | C15H35N3O3Si |
| Molecular Weight | 333.55 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | 3-N'-(1-aminoethyl)-3-N-ethyl-1,1,2-trimethoxy-2-propylsilinane-3,3-diamine |
| SMILES | CCCC1(OC)C(NCC)(NC(C)N)CCC[Si]1(OC)OC |
| InChI | InChI=1S/C15H35N3O3Si/c1-7-10-15(19-4)14(17-8-2,18-13(3)16)11-9-12-22(15,20-5)21-6/h13,17-18H,7-12,16H2,1-6H3 |
| InChIKey | JACIOPOESROUSA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.55 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|