C20H35NO3Si — CID 174681212
1-(3-benzyl-1,1,2-trimethoxy-2-propylsilinan-3-yl)ethanamine (PubChem CID 174681212) has the molecular formula C20H35NO3Si and a molecular weight of 365.59 g/mol. Its IUPAC name is 1-(3-benzyl-1,1,2-trimethoxy-2-propylsilinan-3-yl)ethanamine.
| Compound Name | 1-(3-benzyl-1,1,2-trimethoxy-2-propylsilinan-3-yl)ethanamine |
|---|---|
| PubChem CID | 174681212 |
| Molecular Formula | C20H35NO3Si |
| Molecular Weight | 365.59 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | 1-(3-benzyl-1,1,2-trimethoxy-2-propylsilinan-3-yl)ethanamine |
| SMILES | CCCC1(OC)C(Cc2ccccc2)(C(C)N)CCC[Si]1(OC)OC |
| InChI | InChI=1S/C20H35NO3Si/c1-6-13-20(22-3)19(17(2)21,16-18-11-8-7-9-12-18)14-10-15-25(20,23-4)24-5/h7-9,11-12,17H,6,10,13-16,21H2,1-5H3 |
| InChIKey | GGLDVOKXTARYFL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|