C17H31N3O3Si — CID 174940753
1,1,2-trimethoxy-4-phenyl-2-propylsilinane-3,3,4-triamine (PubChem CID 174940753) has the molecular formula C17H31N3O3Si and a molecular weight of 353.54 g/mol. Its IUPAC name is 1,1,2-trimethoxy-4-phenyl-2-propylsilinane-3,3,4-triamine.
| Compound Name | 1,1,2-trimethoxy-4-phenyl-2-propylsilinane-3,3,4-triamine |
|---|---|
| PubChem CID | 174940753 |
| Molecular Formula | C17H31N3O3Si |
| Molecular Weight | 353.54 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 1,1,2-trimethoxy-4-phenyl-2-propylsilinane-3,3,4-triamine |
| SMILES | CCCC1(OC)C(N)(N)C(N)(c2ccccc2)CC[Si]1(OC)OC |
| InChI | InChI=1S/C17H31N3O3Si/c1-5-11-16(21-2)17(19,20)15(18,14-9-7-6-8-10-14)12-13-24(16,22-3)23-4/h6-10H,5,11-13,18-20H2,1-4H3 |
| InChIKey | LJZKFACFISNFSR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.54 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|