C20H42O4Si — CID 174601366
1,1,2-trimethoxy-4-methyl-3-pentoxy-2,3-dipropylsilinane (PubChem CID 174601366) has the molecular formula C20H42O4Si and a molecular weight of 374.64 g/mol. Its IUPAC name is 1,1,2-trimethoxy-4-methyl-3-pentoxy-2,3-dipropylsilinane.
| Compound Name | 1,1,2-trimethoxy-4-methyl-3-pentoxy-2,3-dipropylsilinane |
|---|---|
| PubChem CID | 174601366 |
| Molecular Formula | C20H42O4Si |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | 1,1,2-trimethoxy-4-methyl-3-pentoxy-2,3-dipropylsilinane |
| SMILES | CCCCCOC1(CCC)C(C)CC[Si](OC)(OC)C1(CCC)OC |
| InChI | InChI=1S/C20H42O4Si/c1-8-11-12-16-24-19(14-9-2)18(4)13-17-25(22-6,23-7)20(19,21-5)15-10-3/h18H,8-17H2,1-7H3 |
| InChIKey | GZHBFWQJHGKPBQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|