C20H36N2O3Si — CID 174731945
1-N'-(3-benzyl-1,1,2-trimethoxy-2-propylsilinan-3-yl)ethane-1,1-diamine (PubChem CID 174731945) has the molecular formula C20H36N2O3Si and a molecular weight of 380.61 g/mol. Its IUPAC name is 1-N'-(3-benzyl-1,1,2-trimethoxy-2-propylsilinan-3-yl)ethane-1,1-diamine.
| Compound Name | 1-N'-(3-benzyl-1,1,2-trimethoxy-2-propylsilinan-3-yl)ethane-1,1-diamine |
|---|---|
| PubChem CID | 174731945 |
| Molecular Formula | C20H36N2O3Si |
| Molecular Weight | 380.61 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | 1-N'-(3-benzyl-1,1,2-trimethoxy-2-propylsilinan-3-yl)ethane-1,1-diamine |
| SMILES | CCCC1(OC)C(Cc2ccccc2)(NC(C)N)CCC[Si]1(OC)OC |
| InChI | InChI=1S/C20H36N2O3Si/c1-6-13-20(23-3)19(22-17(2)21,16-18-11-8-7-9-12-18)14-10-15-26(20,24-4)25-5/h7-9,11-12,17,22H,6,10,13-16,21H2,1-5H3 |
| InChIKey | KXOCZUPVMMGGIM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.61 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|