C20H44Cl4O6Si3 — CID 174831960
diethoxy(dimethyl)silane;1,2,3,4-tetrachlorosilinane;1,1,2,2-tetramethoxysilinane (PubChem CID 174831960) has the molecular formula C20H44Cl4O6Si3 and a molecular weight of 606.64 g/mol. Its IUPAC name is diethoxy(dimethyl)silane;1,2,3,4-tetrachlorosilinane;1,1,2,2-tetramethoxysilinane.
| Compound Name | diethoxy(dimethyl)silane;1,2,3,4-tetrachlorosilinane;1,1,2,2-tetramethoxysilinane |
|---|---|
| PubChem CID | 174831960 |
| Molecular Formula | C20H44Cl4O6Si3 |
| Molecular Weight | 606.64 g/mol |
| Exact Mass | 604.12 |
| IUPAC Name | diethoxy(dimethyl)silane;1,2,3,4-tetrachlorosilinane;1,1,2,2-tetramethoxysilinane |
| SMILES | CCO[Si](C)(C)OCC.COC1(OC)CCCC[Si]1(OC)OC.ClC1CC[SiH](Cl)C(Cl)C1Cl |
| InChI | InChI=1S/C9H20O4Si.C6H16O2Si.C5H8Cl4Si/c1-10-9(11-2)7-5-6-8-14(9,12-3)13-4;1-5-7-9(3,4)8-6-2;6-3-1-2-10(9)5(8)4(3)7/h5-8H2,1-4H3;5-6H2,1-4H3;3-5,10H,1-2H2 |
| InChIKey | GIZJKOBQASFFMP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.64 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|