C16H32N2O4 — CID 139808719
tert-butyl 4-(1,1-dimethoxypentan-2-yl)piperazine-2-carboxylate (PubChem CID 139808719) has the molecular formula C16H32N2O4 and a molecular weight of 316.44 g/mol. Its IUPAC name is tert-butyl 4-(1,1-dimethoxypentan-2-yl)piperazine-2-carboxylate.
| Compound Name | tert-butyl 4-(1,1-dimethoxypentan-2-yl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 139808719 |
| Molecular Formula | C16H32N2O4 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | tert-butyl 4-(1,1-dimethoxypentan-2-yl)piperazine-2-carboxylate |
| SMILES | CCCC(C(OC)OC)N1CCNC(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H32N2O4/c1-7-8-13(15(20-5)21-6)18-10-9-17-12(11-18)14(19)22-16(2,3)4/h12-13,15,17H,7-11H2,1-6H3 |
| InChIKey | BSMOJDFVQVPQOG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|