C21H26N2 — CID 139810238
N,N-diethyl-4-(2H-isoindol-1-yl)-3-propan-2-ylaniline (PubChem CID 139810238) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is N,N-diethyl-4-(2H-isoindol-1-yl)-3-propan-2-ylaniline.
| Compound Name | N,N-diethyl-4-(2H-isoindol-1-yl)-3-propan-2-ylaniline |
|---|---|
| PubChem CID | 139810238 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | N,N-diethyl-4-(2H-isoindol-1-yl)-3-propan-2-ylaniline |
| SMILES | CCN(CC)c1ccc(-c2[nH]cc3ccccc23)c(C(C)C)c1 |
| InChI | InChI=1S/C21H26N2/c1-5-23(6-2)17-11-12-19(20(13-17)15(3)4)21-18-10-8-7-9-16(18)14-22-21/h7-15,22H,5-6H2,1-4H3 |
| InChIKey | BXFMNPJLQSBMLE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |