C20H18N2O7S — CID 139816959
3-(4,6-dimethoxypyrimidin-2-yl)oxy-2-(3-methylsulfonylphenyl)benzoic acid (PubChem CID 139816959) has the molecular formula C20H18N2O7S and a molecular weight of 430.44 g/mol. Its IUPAC name is 3-(4,6-dimethoxypyrimidin-2-yl)oxy-2-(3-methylsulfonylphenyl)benzoic acid.
| Compound Name | 3-(4,6-dimethoxypyrimidin-2-yl)oxy-2-(3-methylsulfonylphenyl)benzoic acid |
|---|---|
| PubChem CID | 139816959 |
| Molecular Formula | C20H18N2O7S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 3-(4,6-dimethoxypyrimidin-2-yl)oxy-2-(3-methylsulfonylphenyl)benzoic acid |
| SMILES | COc1cc(OC)nc(Oc2cccc(C(=O)O)c2-c2cccc(S(C)(=O)=O)c2)n1 |
| InChI | InChI=1S/C20H18N2O7S/c1-27-16-11-17(28-2)22-20(21-16)29-15-9-5-8-14(19(23)24)18(15)12-6-4-7-13(10-12)30(3,25)26/h4-11H,1-3H3,(H,23,24) |
| InChIKey | IKVYYPURCZMQAS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 124.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |