C36H10BCl8F12I — CID 139817890
diphenyliodanium;tetrakis(2,3-dichloro-4,5,6-trifluorophenyl)boranuide (PubChem CID 139817890) has the molecular formula C36H10BCl8F12I and a molecular weight of 1091.79 g/mol. Its IUPAC name is diphenyliodanium;tetrakis(2,3-dichloro-4,5,6-trifluorophenyl)boranuide.
| Compound Name | diphenyliodanium;tetrakis(2,3-dichloro-4,5,6-trifluorophenyl)boranuide |
|---|---|
| PubChem CID | 139817890 |
| Molecular Formula | C36H10BCl8F12I |
| Molecular Weight | 1091.79 g/mol |
| Exact Mass | 1087.72 |
| IUPAC Name | diphenyliodanium;tetrakis(2,3-dichloro-4,5,6-trifluorophenyl)boranuide |
| SMILES | Fc1c(F)c(Cl)c(Cl)c([B-](c2c(F)c(F)c(F)c(Cl)c2Cl)(c2c(F)c(F)c(F)c(Cl)c2Cl)c2c(F)c(F)c(F)c(Cl)c2Cl)c1F.c1ccc([I+]c2ccccc2)cc1 |
| InChI | InChI=1S/C24BCl8F12.C12H10I/c26-5-1(13(34)21(42)17(38)9(5)30)25(2-6(27)10(31)18(39)22(43)14(2)35,3-7(28)11(32)19(40)23(44)15(3)36)4-8(29)12(33)20(41)24(45)16(4)37;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h;1-10H/q-1;+1 |
| InChIKey | NQJZWHRIURXKQS-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1091.79 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|