C42H22BCl8F12IO3 — CID 139829997
[2-[2-(2-ethoxyethoxy)ethoxy]phenyl]-phenyliodanium;tetrakis(2,3-dichloro-4,5,6-trifluorophenyl)boranuide (PubChem CID 139829997) has the molecular formula C42H22BCl8F12IO3 and a molecular weight of 1223.95 g/mol. Its IUPAC name is [2-[2-(2-ethoxyethoxy)ethoxy]phenyl]-phenyliodanium;tetrakis(2,3-dichloro-4,5,6-trifluorophenyl)boranuide.
| Compound Name | [2-[2-(2-ethoxyethoxy)ethoxy]phenyl]-phenyliodanium;tetrakis(2,3-dichloro-4,5,6-trifluorophenyl)boranuide |
|---|---|
| PubChem CID | 139829997 |
| Molecular Formula | C42H22BCl8F12IO3 |
| Molecular Weight | 1223.95 g/mol |
| Exact Mass | 1219.80 |
| IUPAC Name | [2-[2-(2-ethoxyethoxy)ethoxy]phenyl]-phenyliodanium;tetrakis(2,3-dichloro-4,5,6-trifluorophenyl)boranuide |
| SMILES | CCOCCOCCOc1ccccc1[I+]c1ccccc1.Fc1c(F)c(Cl)c(Cl)c([B-](c2c(F)c(F)c(F)c(Cl)c2Cl)(c2c(F)c(F)c(F)c(Cl)c2Cl)c2c(F)c(F)c(F)c(Cl)c2Cl)c1F |
| InChI | InChI=1S/C24BCl8F12.C18H22IO3/c26-5-1(13(34)21(42)17(38)9(5)30)25(2-6(27)10(31)18(39)22(43)14(2)35,3-7(28)11(32)19(40)23(44)15(3)36)4-8(29)12(33)20(41)24(45)16(4)37;1-2-20-12-13-21-14-15-22-18-11-7-6-10-17(18)19-16-8-4-3-5-9-16/h;3-11H,2,12-15H2,1H3/q-1;+1 |
| InChIKey | YQMGWICSKGOABH-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1223.95 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|