C54H39BF20O6Se — CID 139829816
tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tris[2-(2-ethoxyethoxy)phenyl]selanium (PubChem CID 139829816) has the molecular formula C54H39BF20O6Se and a molecular weight of 1253.63 g/mol. Its IUPAC name is tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tris[2-(2-ethoxyethoxy)phenyl]selanium.
| Compound Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tris[2-(2-ethoxyethoxy)phenyl]selanium |
|---|---|
| PubChem CID | 139829816 |
| Molecular Formula | C54H39BF20O6Se |
| Molecular Weight | 1253.63 g/mol |
| Exact Mass | 1254.17 |
| IUPAC Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tris[2-(2-ethoxyethoxy)phenyl]selanium |
| SMILES | CCOCCOc1ccccc1[Se+](c1ccccc1OCCOCC)c1ccccc1OCCOCC.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C30H39O6Se.C24BF20/c1-4-31-19-22-34-25-13-7-10-16-28(25)37(29-17-11-8-14-26(29)35-23-20-32-5-2)30-18-12-9-15-27(30)36-24-21-33-6-3;26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33/h7-18H,4-6,19-24H2,1-3H3;/q+1;-1 |
| InChIKey | HWPHMNGNVVHFEV-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1253.63 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|