C72H51BF20O9Se — CID 139829637
tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tris[2-[2-(2-phenoxyethoxy)ethoxy]phenyl]selanium (PubChem CID 139829637) has the molecular formula C72H51BF20O9Se and a molecular weight of 1529.92 g/mol. Its IUPAC name is tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tris[2-[2-(2-phenoxyethoxy)ethoxy]phenyl]selanium.
| Compound Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tris[2-[2-(2-phenoxyethoxy)ethoxy]phenyl]selanium |
|---|---|
| PubChem CID | 139829637 |
| Molecular Formula | C72H51BF20O9Se |
| Molecular Weight | 1529.92 g/mol |
| Exact Mass | 1530.25 |
| IUPAC Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tris[2-[2-(2-phenoxyethoxy)ethoxy]phenyl]selanium |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.c1ccc(OCCOCCOc2ccccc2[Se+](c2ccccc2OCCOCCOc2ccccc2)c2ccccc2OCCOCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C48H51O9Se.C24BF20/c1-4-16-40(17-5-1)52-34-28-49-31-37-55-43-22-10-13-25-46(43)58(47-26-14-11-23-44(47)56-38-32-50-29-35-53-41-18-6-2-7-19-41)48-27-15-12-24-45(48)57-39-33-51-30-36-54-42-20-8-3-9-21-42;26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33/h1-27H,28-39H2;/q+1;-1 |
| InChIKey | FLCHQHWDRYSTMC-UHFFFAOYSA-N |
| XLogP | 12.47 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 103 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1529.92 |
| LogP ≤ 5 | 12.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|