C47H25BCl4F16O3S — CID 139829931
[2-[2-(2-methoxyethoxy)ethoxy]phenyl]-diphenylsulfanium;tetrakis(2-chloro-3,4,5,6-tetrafluorophenyl)boranuide (PubChem CID 139829931) has the molecular formula C47H25BCl4F16O3S and a molecular weight of 1126.37 g/mol. Its IUPAC name is [2-[2-(2-methoxyethoxy)ethoxy]phenyl]-diphenylsulfanium;tetrakis(2-chloro-3,4,5,6-tetrafluorophenyl)boranuide.
| Compound Name | [2-[2-(2-methoxyethoxy)ethoxy]phenyl]-diphenylsulfanium;tetrakis(2-chloro-3,4,5,6-tetrafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139829931 |
| Molecular Formula | C47H25BCl4F16O3S |
| Molecular Weight | 1126.37 g/mol |
| Exact Mass | 1124.01 |
| IUPAC Name | [2-[2-(2-methoxyethoxy)ethoxy]phenyl]-diphenylsulfanium;tetrakis(2-chloro-3,4,5,6-tetrafluorophenyl)boranuide |
| SMILES | COCCOCCOc1ccccc1[S+](c1ccccc1)c1ccccc1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2Cl)(c2c(F)c(F)c(F)c(F)c2Cl)c2c(F)c(F)c(F)c(F)c2Cl)c(Cl)c1F |
| InChI | InChI=1S/C24BCl4F16.C23H25O3S/c26-5-1(9(30)17(38)21(42)13(5)34)25(2-6(27)14(35)22(43)18(39)10(2)31,3-7(28)15(36)23(44)19(40)11(3)32)4-8(29)16(37)24(45)20(41)12(4)33;1-24-16-17-25-18-19-26-22-14-8-9-15-23(22)27(20-10-4-2-5-11-20)21-12-6-3-7-13-21/h;2-15H,16-19H2,1H3/q-1;+1 |
| InChIKey | BPFSQRPYCGLDKD-UHFFFAOYSA-N |
| XLogP | 12.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1126.37 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|