C54H39BCl4F16O6S — CID 139829813
bis[2-[2-(2-ethoxyethoxy)ethoxy]phenyl]-phenylsulfanium;tetrakis(2-chloro-3,4,5,6-tetrafluorophenyl)boranuide (PubChem CID 139829813) has the molecular formula C54H39BCl4F16O6S and a molecular weight of 1272.56 g/mol. Its IUPAC name is bis[2-[2-(2-ethoxyethoxy)ethoxy]phenyl]-phenylsulfanium;tetrakis(2-chloro-3,4,5,6-tetrafluorophenyl)boranuide.
| Compound Name | bis[2-[2-(2-ethoxyethoxy)ethoxy]phenyl]-phenylsulfanium;tetrakis(2-chloro-3,4,5,6-tetrafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139829813 |
| Molecular Formula | C54H39BCl4F16O6S |
| Molecular Weight | 1272.56 g/mol |
| Exact Mass | 1270.11 |
| IUPAC Name | bis[2-[2-(2-ethoxyethoxy)ethoxy]phenyl]-phenylsulfanium;tetrakis(2-chloro-3,4,5,6-tetrafluorophenyl)boranuide |
| SMILES | CCOCCOCCOc1ccccc1[S+](c1ccccc1)c1ccccc1OCCOCCOCC.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2Cl)(c2c(F)c(F)c(F)c(F)c2Cl)c2c(F)c(F)c(F)c(F)c2Cl)c(Cl)c1F |
| InChI | InChI=1S/C30H39O6S.C24BCl4F16/c1-3-31-18-20-33-22-24-35-27-14-8-10-16-29(27)37(26-12-6-5-7-13-26)30-17-11-9-15-28(30)36-25-23-34-21-19-32-4-2;26-5-1(9(30)17(38)21(42)13(5)34)25(2-6(27)14(35)22(43)18(39)10(2)31,3-7(28)15(36)23(44)19(40)11(3)32)4-8(29)16(37)24(45)20(41)12(4)33/h5-17H,3-4,18-25H2,1-2H3;/q+1;-1 |
| InChIKey | MRFVODPORDQUQV-UHFFFAOYSA-N |
| XLogP | 13.55 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1272.56 |
| LogP ≤ 5 | 13.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|