C58H31BF20O4Se — CID 139829890
bis[2-(2-phenoxyethoxy)phenyl]-phenylselanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139829890) has the molecular formula C58H31BF20O4Se and a molecular weight of 1261.61 g/mol. Its IUPAC name is bis[2-(2-phenoxyethoxy)phenyl]-phenylselanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | bis[2-(2-phenoxyethoxy)phenyl]-phenylselanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139829890 |
| Molecular Formula | C58H31BF20O4Se |
| Molecular Weight | 1261.61 g/mol |
| Exact Mass | 1262.12 |
| IUPAC Name | bis[2-(2-phenoxyethoxy)phenyl]-phenylselanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.c1ccc(OCCOc2ccccc2[Se+](c2ccccc2)c2ccccc2OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C34H31O4Se.C24BF20/c1-4-14-28(15-5-1)35-24-26-37-31-20-10-12-22-33(31)39(30-18-8-3-9-19-30)34-23-13-11-21-32(34)38-27-25-36-29-16-6-2-7-17-29;26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33/h1-23H,24-27H2;/q+1;-1 |
| InChIKey | FLQVIBXCVCYBFH-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1261.61 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|