C34H38F2N10O4 — CID 139825846
[4-[[2-[(2R,3R)-2-(2,4-difluorophenyl)-2-hydroxy-3-[2-oxo-3-[4-(tetrazol-1-yl)phenyl]imidazolidin-1-yl]butyl]-3H-1,2,4-triazol-4-yl]methyl]-2,6-dimethylphenyl] 2-(methylamino)acetate (PubChem CID 139825846) has the molecular formula C34H38F2N10O4 and a molecular weight of 688.74 g/mol. Its IUPAC name is [4-[[2-[(2R,3R)-2-(2,4-difluorophenyl)-2-hydroxy-3-[2-oxo-3-[4-(tetrazol-1-yl)phenyl]imidazolidin-1-yl]butyl]-3H-1,2,4-triazol-4-yl]methyl]-2,6-dimethylphenyl] 2-(methylamino)acetate.
| Compound Name | [4-[[2-[(2R,3R)-2-(2,4-difluorophenyl)-2-hydroxy-3-[2-oxo-3-[4-(tetrazol-1-yl)phenyl]imidazolidin-1-yl]butyl]-3H-1,2,4-triazol-4-yl]methyl]-2,6-dimethylphenyl] 2-(methylamino)acetate |
|---|---|
| PubChem CID | 139825846 |
| Molecular Formula | C34H38F2N10O4 |
| Molecular Weight | 688.74 g/mol |
| Exact Mass | 688.30 |
| IUPAC Name | [4-[[2-[(2R,3R)-2-(2,4-difluorophenyl)-2-hydroxy-3-[2-oxo-3-[4-(tetrazol-1-yl)phenyl]imidazolidin-1-yl]butyl]-3H-1,2,4-triazol-4-yl]methyl]-2,6-dimethylphenyl] 2-(methylamino)acetate |
| SMILES | CNCC(=O)Oc1c(C)cc(CN2C=NN(C[C@](O)(c3ccc(F)cc3F)[C@@H](C)N3CCN(c4ccc(-n5cnnn5)cc4)C3=O)C2)cc1C |
| InChI | InChI=1S/C34H38F2N10O4/c1-22-13-25(14-23(2)32(22)50-31(47)16-37-4)17-42-20-39-43(21-42)18-34(49,29-10-5-26(35)15-30(29)36)24(3)44-11-12-45(33(44)48)27-6-8-28(9-7-27)46-19-38-40-41-46/h5-10,13-15,19-20,24,37,49H,11-12,16-18,21H2,1-4H3/t24-,34-/m1/s1 |
| InChIKey | USZLFCMADJYIEU-PBUKZNKTSA-N |
| XLogP | 2.92 |
| TPSA | 144.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.74 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|