C30H32F2N8O3S — CID 142626628
[4-[[2-[(2R)-2-(2,4-difluorophenyl)-2-hydroxy-3-methyl-3-[6-(1,2,4-triazol-1-yl)pyridazin-3-yl]sulfanylbutyl]-3H-1,2,4-triazol-4-yl]methyl]-2,6-dimethylphenyl] acetate (PubChem CID 142626628) has the molecular formula C30H32F2N8O3S and a molecular weight of 622.70 g/mol. Its IUPAC name is [4-[[2-[(2R)-2-(2,4-difluorophenyl)-2-hydroxy-3-methyl-3-[6-(1,2,4-triazol-1-yl)pyridazin-3-yl]sulfanylbutyl]-3H-1,2,4-triazol-4-yl]methyl]-2,6-dimethylphenyl] acetate.
| Compound Name | [4-[[2-[(2R)-2-(2,4-difluorophenyl)-2-hydroxy-3-methyl-3-[6-(1,2,4-triazol-1-yl)pyridazin-3-yl]sulfanylbutyl]-3H-1,2,4-triazol-4-yl]methyl]-2,6-dimethylphenyl] acetate |
|---|---|
| PubChem CID | 142626628 |
| Molecular Formula | C30H32F2N8O3S |
| Molecular Weight | 622.70 g/mol |
| Exact Mass | 622.23 |
| IUPAC Name | [4-[[2-[(2R)-2-(2,4-difluorophenyl)-2-hydroxy-3-methyl-3-[6-(1,2,4-triazol-1-yl)pyridazin-3-yl]sulfanylbutyl]-3H-1,2,4-triazol-4-yl]methyl]-2,6-dimethylphenyl] acetate |
| SMILES | CC(=O)Oc1c(C)cc(CN2C=NN(C[C@](O)(c3ccc(F)cc3F)C(C)(C)Sc3ccc(-n4cncn4)nn3)C2)cc1C |
| InChI | InChI=1S/C30H32F2N8O3S/c1-19-10-22(11-20(2)28(19)43-21(3)41)13-38-17-35-39(18-38)14-30(42,24-7-6-23(31)12-25(24)32)29(4,5)44-27-9-8-26(36-37-27)40-16-33-15-34-40/h6-12,15-17,42H,13-14,18H2,1-5H3/t30-/m0/s1 |
| InChIKey | XAKRYNVRHIWXJM-PMERELPUSA-N |
| XLogP | 4.35 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.70 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|