C20H24N2O3S — CID 139827468
1-[[5-(hydroxymethyl)cyclopenten-1-yl]methyl]-6-phenylsulfanyl-5-propan-2-ylpyrimidine-2,4-dione (PubChem CID 139827468) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 1-[[5-(hydroxymethyl)cyclopenten-1-yl]methyl]-6-phenylsulfanyl-5-propan-2-ylpyrimidine-2,4-dione.
| Compound Name | 1-[[5-(hydroxymethyl)cyclopenten-1-yl]methyl]-6-phenylsulfanyl-5-propan-2-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139827468 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-[[5-(hydroxymethyl)cyclopenten-1-yl]methyl]-6-phenylsulfanyl-5-propan-2-ylpyrimidine-2,4-dione |
| SMILES | CC(C)c1c(Sc2ccccc2)n(CC2=CCCC2CO)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H24N2O3S/c1-13(2)17-18(24)21-20(25)22(11-14-7-6-8-15(14)12-23)19(17)26-16-9-4-3-5-10-16/h3-5,7,9-10,13,15,23H,6,8,11-12H2,1-2H3,(H,21,24,25) |
| InChIKey | DBHRTMBYDVBZBH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|