C10H23NO2Si — CID 139828767
1-(2,2-dimethylpropyl)-2,2-dimethoxyazasilolidine (PubChem CID 139828767) has the molecular formula C10H23NO2Si and a molecular weight of 217.38 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-2,2-dimethoxyazasilolidine.
| Compound Name | 1-(2,2-dimethylpropyl)-2,2-dimethoxyazasilolidine |
|---|---|
| PubChem CID | 139828767 |
| Molecular Formula | C10H23NO2Si |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-2,2-dimethoxyazasilolidine |
| SMILES | CO[Si]1(OC)CCCN1CC(C)(C)C |
| InChI | InChI=1S/C10H23NO2Si/c1-10(2,3)9-11-7-6-8-14(11,12-4)13-5/h6-9H2,1-5H3 |
| InChIKey | SXIKCKIUBJIUQS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|