C17H41NO5Si3 — CID 175462163
6-[3-(2,2-dimethoxyazasilolidin-1-yl)propylsilyl]hexan-2-yl-trimethoxysilane (PubChem CID 175462163) has the molecular formula C17H41NO5Si3 and a molecular weight of 423.78 g/mol. Its IUPAC name is 6-[3-(2,2-dimethoxyazasilolidin-1-yl)propylsilyl]hexan-2-yl-trimethoxysilane.
| Compound Name | 6-[3-(2,2-dimethoxyazasilolidin-1-yl)propylsilyl]hexan-2-yl-trimethoxysilane |
|---|---|
| PubChem CID | 175462163 |
| Molecular Formula | C17H41NO5Si3 |
| Molecular Weight | 423.78 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 6-[3-(2,2-dimethoxyazasilolidin-1-yl)propylsilyl]hexan-2-yl-trimethoxysilane |
| SMILES | CO[Si](OC)(OC)C(C)CCCC[SiH2]CCCN1CCC[Si]1(OC)OC |
| InChI | InChI=1S/C17H41NO5Si3/c1-17(26(21-4,22-5)23-6)11-7-8-14-24-15-9-12-18-13-10-16-25(18,19-2)20-3/h17H,7-16,24H2,1-6H3 |
| InChIKey | JGCYPWNBHDWESZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.78 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|