C20H48N2O8Si3 — CID 162724360
3-(2,2-dimethoxyazasilolidin-1-yl)-N,N-bis(3-trimethoxysilylpropyl)propan-1-amine (PubChem CID 162724360) has the molecular formula C20H48N2O8Si3 and a molecular weight of 528.87 g/mol. Its IUPAC name is 3-(2,2-dimethoxyazasilolidin-1-yl)-N,N-bis(3-trimethoxysilylpropyl)propan-1-amine.
| Compound Name | 3-(2,2-dimethoxyazasilolidin-1-yl)-N,N-bis(3-trimethoxysilylpropyl)propan-1-amine |
|---|---|
| PubChem CID | 162724360 |
| Molecular Formula | C20H48N2O8Si3 |
| Molecular Weight | 528.87 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | 3-(2,2-dimethoxyazasilolidin-1-yl)-N,N-bis(3-trimethoxysilylpropyl)propan-1-amine |
| SMILES | CO[Si](CCCN(CCCN1CCC[Si]1(OC)OC)CCC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C20H48N2O8Si3/c1-23-31(24-2)18-12-17-22(31)16-9-13-21(14-10-19-32(25-3,26-4)27-5)15-11-20-33(28-6,29-7)30-8/h9-20H2,1-8H3 |
| InChIKey | KKVCZEVOANCWTQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 80.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.87 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|