C19H44N2O5Si2 — CID 174990503
3-(2,2-diethoxyazasilolidin-1-yl)-N-(3-triethoxysilylpropyl)propan-1-amine (PubChem CID 174990503) has the molecular formula C19H44N2O5Si2 and a molecular weight of 436.74 g/mol. Its IUPAC name is 3-(2,2-diethoxyazasilolidin-1-yl)-N-(3-triethoxysilylpropyl)propan-1-amine.
| Compound Name | 3-(2,2-diethoxyazasilolidin-1-yl)-N-(3-triethoxysilylpropyl)propan-1-amine |
|---|---|
| PubChem CID | 174990503 |
| Molecular Formula | C19H44N2O5Si2 |
| Molecular Weight | 436.74 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 3-(2,2-diethoxyazasilolidin-1-yl)-N-(3-triethoxysilylpropyl)propan-1-amine |
| SMILES | CCO[Si](CCCNCCCN1CCC[Si]1(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C19H44N2O5Si2/c1-6-22-27(23-7-2)18-13-17-21(27)16-11-14-20-15-12-19-28(24-8-3,25-9-4)26-10-5/h20H,6-19H2,1-5H3 |
| InChIKey | PYWXHBZRXBUVJK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.74 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|