C20H46N2O6Si2 — CID 59305951
3-triethoxysilyl-N-[2-(2-triethoxysilylazetidin-1-yl)ethyl]propan-1-amine (PubChem CID 59305951) has the molecular formula C20H46N2O6Si2 and a molecular weight of 466.77 g/mol. Its IUPAC name is 3-triethoxysilyl-N-[2-(2-triethoxysilylazetidin-1-yl)ethyl]propan-1-amine.
| Compound Name | 3-triethoxysilyl-N-[2-(2-triethoxysilylazetidin-1-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 59305951 |
| Molecular Formula | C20H46N2O6Si2 |
| Molecular Weight | 466.77 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | 3-triethoxysilyl-N-[2-(2-triethoxysilylazetidin-1-yl)ethyl]propan-1-amine |
| SMILES | CCO[Si](CCCNCCN1CCC1[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C20H46N2O6Si2/c1-7-23-29(24-8-2,25-9-3)19-13-15-21-16-18-22-17-14-20(22)30(26-10-4,27-11-5)28-12-6/h20-21H,7-19H2,1-6H3 |
| InChIKey | CLMJAYVPUQSYIF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.77 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|