C21H45NO7Si2 — CID 175411270
3-triethoxysilylpropyl 4-(2,2-diethoxyazasilolidin-1-yl)-3-methylbutanoate (PubChem CID 175411270) has the molecular formula C21H45NO7Si2 and a molecular weight of 479.76 g/mol. Its IUPAC name is 3-triethoxysilylpropyl 4-(2,2-diethoxyazasilolidin-1-yl)-3-methylbutanoate.
| Compound Name | 3-triethoxysilylpropyl 4-(2,2-diethoxyazasilolidin-1-yl)-3-methylbutanoate |
|---|---|
| PubChem CID | 175411270 |
| Molecular Formula | C21H45NO7Si2 |
| Molecular Weight | 479.76 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | 3-triethoxysilylpropyl 4-(2,2-diethoxyazasilolidin-1-yl)-3-methylbutanoate |
| SMILES | CCO[Si](CCCOC(=O)CC(C)CN1CCC[Si]1(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C21H45NO7Si2/c1-7-25-30(26-8-2)16-12-14-22(30)19-20(6)18-21(23)24-15-13-17-31(27-9-3,28-10-4)29-11-5/h20H,7-19H2,1-6H3 |
| InChIKey | WHVCYBXJNKTZGQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.76 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|