C16H37NO5Si2 — CID 140943183
1-(2,2-diethoxyazasilolidin-1-yl)propyl-triethoxysilane (PubChem CID 140943183) has the molecular formula C16H37NO5Si2 and a molecular weight of 379.65 g/mol. Its IUPAC name is 1-(2,2-diethoxyazasilolidin-1-yl)propyl-triethoxysilane.
| Compound Name | 1-(2,2-diethoxyazasilolidin-1-yl)propyl-triethoxysilane |
|---|---|
| PubChem CID | 140943183 |
| Molecular Formula | C16H37NO5Si2 |
| Molecular Weight | 379.65 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | 1-(2,2-diethoxyazasilolidin-1-yl)propyl-triethoxysilane |
| SMILES | CCO[Si](OCC)(OCC)C(CC)N1CCC[Si]1(OCC)OCC |
| InChI | InChI=1S/C16H37NO5Si2/c1-7-16(24(20-10-4,21-11-5)22-12-6)17-14-13-15-23(17,18-8-2)19-9-3/h16H,7-15H2,1-6H3 |
| InChIKey | FLCGAKMKQBQZSX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.65 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|