C5H15NO2Si2 — CID 154510834
(2,2-dimethoxyazasilolidin-1-yl)silane (PubChem CID 154510834) has the molecular formula C5H15NO2Si2 and a molecular weight of 177.35 g/mol. Its IUPAC name is (2,2-dimethoxyazasilolidin-1-yl)silane.
| Compound Name | (2,2-dimethoxyazasilolidin-1-yl)silane |
|---|---|
| PubChem CID | 154510834 |
| Molecular Formula | C5H15NO2Si2 |
| Molecular Weight | 177.35 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | (2,2-dimethoxyazasilolidin-1-yl)silane |
| SMILES | CO[Si]1(OC)CCCN1[SiH3] |
| InChI | InChI=1S/C5H15NO2Si2/c1-7-10(8-2)5-3-4-6(10)9/h3-5H2,1-2,9H3 |
| InChIKey | MTFREZZMCLVZQX-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.35 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|