C21H56N2O5Si5 — CID 67424237
(2,2-dimethoxyazasilolidin-1-yl)-trimethylsilane;1-trimethoxysilyl-N,N-bis(trimethylsilyl)butan-1-amine (PubChem CID 67424237) has the molecular formula C21H56N2O5Si5 and a molecular weight of 557.12 g/mol. Its IUPAC name is (2,2-dimethoxyazasilolidin-1-yl)-trimethylsilane;1-trimethoxysilyl-N,N-bis(trimethylsilyl)butan-1-amine.
| Compound Name | (2,2-dimethoxyazasilolidin-1-yl)-trimethylsilane;1-trimethoxysilyl-N,N-bis(trimethylsilyl)butan-1-amine |
|---|---|
| PubChem CID | 67424237 |
| Molecular Formula | C21H56N2O5Si5 |
| Molecular Weight | 557.12 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | (2,2-dimethoxyazasilolidin-1-yl)-trimethylsilane;1-trimethoxysilyl-N,N-bis(trimethylsilyl)butan-1-amine |
| SMILES | CCCC(N([Si](C)(C)C)[Si](C)(C)C)[Si](OC)(OC)OC.CO[Si]1(OC)CCCN1[Si](C)(C)C |
| InChI | InChI=1S/C13H35NO3Si3.C8H21NO2Si2/c1-11-12-13(20(15-2,16-3)17-4)14(18(5,6)7)19(8,9)10;1-10-13(11-2)8-6-7-9(13)12(3,4)5/h13H,11-12H2,1-10H3;6-8H2,1-5H3 |
| InChIKey | NBBHKGLTBNCCBM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 52.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.12 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|