About 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2-dimethoxyazasilolidine
1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2-dimethoxyazasilolidine (PubChem CID 171734787) has the molecular formula C13H23NO2Si
and a molecular weight of 253.42 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2-dimethoxyazasilolidine.
Molecular Properties
| Compound Name | 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2-dimethoxyazasilolidine |
| PubChem CID | 171734787 |
| Molecular Formula | C13H23NO2Si |
| Molecular Weight | 253.42 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2-dimethoxyazasilolidine |
| SMILES | CO[Si]1(OC)CCCN1CC1CC2C=CC1C2 |
| InChI | InChI=1S/C13H23NO2Si/c1-15-17(16-2)7-3-6-14(17)10-13-9-11-4-5-12(13)8-11/h4-5,11-13H,3,6-10H2,1-2H3 |
| InChIKey | NBDSWIGSKZPGPG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2-dimethoxyazasilolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2-dimethoxyazasilolidine?
The IUPAC name of 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2-dimethoxyazasilolidine (CID 171734787) is 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2-dimethoxyazasilolidine.
What is the SMILES notation for 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2-dimethoxyazasilolidine?
The canonical SMILES for 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2-dimethoxyazasilolidine is CO[Si]1(OC)CCCN1CC1CC2C=CC1C2.
What is the InChIKey of 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2-dimethoxyazasilolidine?
The InChIKey is NBDSWIGSKZPGPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2Si/c1-15-17(16-2)7-3-6-14(17)10-13-9-11-4-5-12(13)8-11/h4-5,11-13H,3,6-10H2,1-2H3.
What are the key properties of 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2-dimethoxyazasilolidine?
1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2-dimethoxyazasilolidine has a molecular weight of 253.42 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2-dimethoxyazasilolidine is sourced from PubChem (CID 171734787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).