C13H23NO2Si — CID 171734787
1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2-dimethoxyazasilolidine (PubChem CID 171734787) has the molecular formula C13H23NO2Si and a molecular weight of 253.42 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2-dimethoxyazasilolidine.
| Compound Name | 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2-dimethoxyazasilolidine |
|---|---|
| PubChem CID | 171734787 |
| Molecular Formula | C13H23NO2Si |
| Molecular Weight | 253.42 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2-dimethoxyazasilolidine |
| SMILES | CO[Si]1(OC)CCCN1CC1CC2C=CC1C2 |
| InChI | InChI=1S/C13H23NO2Si/c1-15-17(16-2)7-3-6-14(17)10-13-9-11-4-5-12(13)8-11/h4-5,11-13H,3,6-10H2,1-2H3 |
| InChIKey | NBDSWIGSKZPGPG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|