C11H23NO2Si — CID 139828765
1-cyclopentyl-2,2-dimethoxyazasilinane (PubChem CID 139828765) has the molecular formula C11H23NO2Si and a molecular weight of 229.40 g/mol. Its IUPAC name is 1-cyclopentyl-2,2-dimethoxyazasilinane.
| Compound Name | 1-cyclopentyl-2,2-dimethoxyazasilinane |
|---|---|
| PubChem CID | 139828765 |
| Molecular Formula | C11H23NO2Si |
| Molecular Weight | 229.40 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 1-cyclopentyl-2,2-dimethoxyazasilinane |
| SMILES | CO[Si]1(OC)CCCCN1C1CCCC1 |
| InChI | InChI=1S/C11H23NO2Si/c1-13-15(14-2)10-6-5-9-12(15)11-7-3-4-8-11/h11H,3-10H2,1-2H3 |
| InChIKey | VBGJAGWUKXVGIM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|