C14H32N2O2Si — CID 139828740
1,3-bis(2,2-dimethylpropyl)-2,2-dimethoxy-1,3,2-diazasilolidine (PubChem CID 139828740) has the molecular formula C14H32N2O2Si and a molecular weight of 288.51 g/mol. Its IUPAC name is 1,3-bis(2,2-dimethylpropyl)-2,2-dimethoxy-1,3,2-diazasilolidine.
| Compound Name | 1,3-bis(2,2-dimethylpropyl)-2,2-dimethoxy-1,3,2-diazasilolidine |
|---|---|
| PubChem CID | 139828740 |
| Molecular Formula | C14H32N2O2Si |
| Molecular Weight | 288.51 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 1,3-bis(2,2-dimethylpropyl)-2,2-dimethoxy-1,3,2-diazasilolidine |
| SMILES | CO[Si]1(OC)N(CC(C)(C)C)CCN1CC(C)(C)C |
| InChI | InChI=1S/C14H32N2O2Si/c1-13(2,3)11-15-9-10-16(12-14(4,5)6)19(15,17-7)18-8/h9-12H2,1-8H3 |
| InChIKey | QQGXRCPKQSCJDO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|