C22H24N2O3 — CID 139829299
(8-phenyldiazenyl-2,3,4,5,6,7-hexahydro-1-benzoxonin-11-yl) 2-methylprop-2-enoate (PubChem CID 139829299) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is (8-phenyldiazenyl-2,3,4,5,6,7-hexahydro-1-benzoxonin-11-yl) 2-methylprop-2-enoate.
| Compound Name | (8-phenyldiazenyl-2,3,4,5,6,7-hexahydro-1-benzoxonin-11-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139829299 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (8-phenyldiazenyl-2,3,4,5,6,7-hexahydro-1-benzoxonin-11-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(/N=N/c2ccccc2)c2c1OCCCCCC2 |
| InChI | InChI=1S/C22H24N2O3/c1-16(2)22(25)27-20-14-13-19(24-23-17-10-6-5-7-11-17)18-12-8-3-4-9-15-26-21(18)20/h5-7,10-11,13-14H,1,3-4,8-9,12,15H2,2H3/b24-23+ |
| InChIKey | LXKLOKHUNFOMFH-WCWDXBQESA-N |
| XLogP | 6.08 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|