C9H15BrO3 — CID 139830701
4-(bromomethyl)-1,5,7-trioxaspiro[5.5]undecane (PubChem CID 139830701) has the molecular formula C9H15BrO3 and a molecular weight of 251.12 g/mol. Its IUPAC name is 4-(bromomethyl)-1,5,7-trioxaspiro[5.5]undecane.
| Compound Name | 4-(bromomethyl)-1,5,7-trioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 139830701 |
| Molecular Formula | C9H15BrO3 |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 4-(bromomethyl)-1,5,7-trioxaspiro[5.5]undecane |
| SMILES | BrCC1CCOC2(CCCCO2)O1 |
| InChI | InChI=1S/C9H15BrO3/c10-7-8-3-6-12-9(13-8)4-1-2-5-11-9/h8H,1-7H2 |
| InChIKey | MDTMNQXXMWRHOF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|