C6H10O9S — CID 139833959
4-(2,2-dihydroxyethoxy)-4-oxo-3-sulfobutanoic acid (PubChem CID 139833959) has the molecular formula C6H10O9S and a molecular weight of 258.20 g/mol. Its IUPAC name is 4-(2,2-dihydroxyethoxy)-4-oxo-3-sulfobutanoic acid.
| Compound Name | 4-(2,2-dihydroxyethoxy)-4-oxo-3-sulfobutanoic acid |
|---|---|
| PubChem CID | 139833959 |
| Molecular Formula | C6H10O9S |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 4-(2,2-dihydroxyethoxy)-4-oxo-3-sulfobutanoic acid |
| SMILES | O=C(O)CC(C(=O)OCC(O)O)S(=O)(=O)O |
| InChI | InChI=1S/C6H10O9S/c7-4(8)1-3(16(12,13)14)6(11)15-2-5(9)10/h3,5,9-10H,1-2H2,(H,7,8)(H,12,13,14) |
| InChIKey | GTEMDTSGZSWAPA-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|