C10H18O7S — CID 87611121
4-(2,3-dimethylbutan-2-yloxy)-4-oxo-3-sulfobutanoic acid (PubChem CID 87611121) has the molecular formula C10H18O7S and a molecular weight of 282.31 g/mol. Its IUPAC name is 4-(2,3-dimethylbutan-2-yloxy)-4-oxo-3-sulfobutanoic acid.
| Compound Name | 4-(2,3-dimethylbutan-2-yloxy)-4-oxo-3-sulfobutanoic acid |
|---|---|
| PubChem CID | 87611121 |
| Molecular Formula | C10H18O7S |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 4-(2,3-dimethylbutan-2-yloxy)-4-oxo-3-sulfobutanoic acid |
| SMILES | CC(C)C(C)(C)OC(=O)C(CC(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C10H18O7S/c1-6(2)10(3,4)17-9(13)7(5-8(11)12)18(14,15)16/h6-7H,5H2,1-4H3,(H,11,12)(H,14,15,16) |
| InChIKey | UMWQKNUHJBCPFL-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|