C8H7F7O7S — CID 22157918
4-(1,2,2,3,3,4,4-heptafluorobutoxy)-4-oxo-3-sulfobutanoic acid (PubChem CID 22157918) has the molecular formula C8H7F7O7S and a molecular weight of 380.19 g/mol. Its IUPAC name is 4-(1,2,2,3,3,4,4-heptafluorobutoxy)-4-oxo-3-sulfobutanoic acid.
| Compound Name | 4-(1,2,2,3,3,4,4-heptafluorobutoxy)-4-oxo-3-sulfobutanoic acid |
|---|---|
| PubChem CID | 22157918 |
| Molecular Formula | C8H7F7O7S |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | 4-(1,2,2,3,3,4,4-heptafluorobutoxy)-4-oxo-3-sulfobutanoic acid |
| SMILES | O=C(O)CC(C(=O)OC(F)C(F)(F)C(F)(F)C(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C8H7F7O7S/c9-5(10)7(12,13)8(14,15)6(11)22-4(18)2(1-3(16)17)23(19,20)21/h2,5-6H,1H2,(H,16,17)(H,19,20,21) |
| InChIKey | PHANAAYJISRCSN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|