C18H30O4S3 — CID 139834242
[2-propan-2-ylsulfanyl-2-(2-propan-2-ylsulfanyl-1-prop-2-enoyloxypropan-2-yl)sulfanylpropyl] prop-2-enoate (PubChem CID 139834242) has the molecular formula C18H30O4S3 and a molecular weight of 406.64 g/mol. Its IUPAC name is [2-propan-2-ylsulfanyl-2-(2-propan-2-ylsulfanyl-1-prop-2-enoyloxypropan-2-yl)sulfanylpropyl] prop-2-enoate.
| Compound Name | [2-propan-2-ylsulfanyl-2-(2-propan-2-ylsulfanyl-1-prop-2-enoyloxypropan-2-yl)sulfanylpropyl] prop-2-enoate |
|---|---|
| PubChem CID | 139834242 |
| Molecular Formula | C18H30O4S3 |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | [2-propan-2-ylsulfanyl-2-(2-propan-2-ylsulfanyl-1-prop-2-enoyloxypropan-2-yl)sulfanylpropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)(SC(C)C)SC(C)(COC(=O)C=C)SC(C)C |
| InChI | InChI=1S/C18H30O4S3/c1-9-15(19)21-11-17(7,23-13(3)4)25-18(8,24-14(5)6)12-22-16(20)10-2/h9-10,13-14H,1-2,11-12H2,3-8H3 |
| InChIKey | PVVVSAVPGMISSQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|