C14H13BrN2O5S — CID 139836138
4-bromo-3-[4-(2-methylpropoxy)-3-nitrophenyl]-1,2-thiazole-5-carboxylic acid (PubChem CID 139836138) has the molecular formula C14H13BrN2O5S and a molecular weight of 401.24 g/mol. Its IUPAC name is 4-bromo-3-[4-(2-methylpropoxy)-3-nitrophenyl]-1,2-thiazole-5-carboxylic acid.
| Compound Name | 4-bromo-3-[4-(2-methylpropoxy)-3-nitrophenyl]-1,2-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 139836138 |
| Molecular Formula | C14H13BrN2O5S |
| Molecular Weight | 401.24 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | 4-bromo-3-[4-(2-methylpropoxy)-3-nitrophenyl]-1,2-thiazole-5-carboxylic acid |
| SMILES | CC(C)COc1ccc(-c2nsc(C(=O)O)c2Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13BrN2O5S/c1-7(2)6-22-10-4-3-8(5-9(10)17(20)21)12-11(15)13(14(18)19)23-16-12/h3-5,7H,6H2,1-2H3,(H,18,19) |
| InChIKey | OLBZMFKIMAWKQW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.24 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|