C22H24O5 — CID 139839008
2-[3-benzoyl-4-hydroxy-5-(1-methylcyclohexyl)phenoxy]acetic acid (PubChem CID 139839008) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is 2-[3-benzoyl-4-hydroxy-5-(1-methylcyclohexyl)phenoxy]acetic acid.
| Compound Name | 2-[3-benzoyl-4-hydroxy-5-(1-methylcyclohexyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 139839008 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 2-[3-benzoyl-4-hydroxy-5-(1-methylcyclohexyl)phenoxy]acetic acid |
| SMILES | CC1(c2cc(OCC(=O)O)cc(C(=O)c3ccccc3)c2O)CCCCC1 |
| InChI | InChI=1S/C22H24O5/c1-22(10-6-3-7-11-22)18-13-16(27-14-19(23)24)12-17(21(18)26)20(25)15-8-4-2-5-9-15/h2,4-5,8-9,12-13,26H,3,6-7,10-11,14H2,1H3,(H,23,24) |
| InChIKey | CMTJYNATYMFZEE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |