C19H19FO3 — CID 174538380
5-(2-fluorophenyl)-2-hydroxy-3-(1-methylcyclopentyl)benzoic acid (PubChem CID 174538380) has the molecular formula C19H19FO3 and a molecular weight of 314.36 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-2-hydroxy-3-(1-methylcyclopentyl)benzoic acid.
| Compound Name | 5-(2-fluorophenyl)-2-hydroxy-3-(1-methylcyclopentyl)benzoic acid |
|---|---|
| PubChem CID | 174538380 |
| Molecular Formula | C19H19FO3 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 5-(2-fluorophenyl)-2-hydroxy-3-(1-methylcyclopentyl)benzoic acid |
| SMILES | CC1(c2cc(-c3ccccc3F)cc(C(=O)O)c2O)CCCC1 |
| InChI | InChI=1S/C19H19FO3/c1-19(8-4-5-9-19)15-11-12(10-14(17(15)21)18(22)23)13-6-2-3-7-16(13)20/h2-3,6-7,10-11,21H,4-5,8-9H2,1H3,(H,22,23) |
| InChIKey | FKWKTCWGTBEZNF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |