C18H23NO4 — CID 139840097
2-(3-methoxy-N-(3-methoxyphenyl)anilino)butane-1,4-diol (PubChem CID 139840097) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-(3-methoxy-N-(3-methoxyphenyl)anilino)butane-1,4-diol.
| Compound Name | 2-(3-methoxy-N-(3-methoxyphenyl)anilino)butane-1,4-diol |
|---|---|
| PubChem CID | 139840097 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2-(3-methoxy-N-(3-methoxyphenyl)anilino)butane-1,4-diol |
| SMILES | COc1cccc(N(c2cccc(OC)c2)C(CO)CCO)c1 |
| InChI | InChI=1S/C18H23NO4/c1-22-17-7-3-5-14(11-17)19(16(13-21)9-10-20)15-6-4-8-18(12-15)23-2/h3-8,11-12,16,20-21H,9-10,13H2,1-2H3 |
| InChIKey | WKWVQMSNVRJGPD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |