C23H29NO5Si — CID 139843008
methyl 2-[5-[N-[[dimethyl(phenyl)silyl]methoxy]-C-methylcarbonimidoyl]-2-methylphenoxy]-3-methoxyprop-2-enoate (PubChem CID 139843008) has the molecular formula C23H29NO5Si and a molecular weight of 427.57 g/mol. Its IUPAC name is methyl 2-[5-[N-[[dimethyl(phenyl)silyl]methoxy]-C-methylcarbonimidoyl]-2-methylphenoxy]-3-methoxyprop-2-enoate.
| Compound Name | methyl 2-[5-[N-[[dimethyl(phenyl)silyl]methoxy]-C-methylcarbonimidoyl]-2-methylphenoxy]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 139843008 |
| Molecular Formula | C23H29NO5Si |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | methyl 2-[5-[N-[[dimethyl(phenyl)silyl]methoxy]-C-methylcarbonimidoyl]-2-methylphenoxy]-3-methoxyprop-2-enoate |
| SMILES | COC=C(Oc1cc(C(C)=NOC[Si](C)(C)c2ccccc2)ccc1C)C(=O)OC |
| InChI | InChI=1S/C23H29NO5Si/c1-17-12-13-19(14-21(17)29-22(15-26-3)23(25)27-4)18(2)24-28-16-30(5,6)20-10-8-7-9-11-20/h7-15H,16H2,1-6H3 |
| InChIKey | OIADLJVUBYPJFE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|