C25H33NO5Si — CID 139842992
methyl 2-[5-[N-[[(2,3-dimethylphenyl)-dimethylsilyl]methoxy]-C-methylcarbonimidoyl]-2-methylphenoxy]-3-methoxyprop-2-enoate (PubChem CID 139842992) has the molecular formula C25H33NO5Si and a molecular weight of 455.63 g/mol. Its IUPAC name is methyl 2-[5-[N-[[(2,3-dimethylphenyl)-dimethylsilyl]methoxy]-C-methylcarbonimidoyl]-2-methylphenoxy]-3-methoxyprop-2-enoate.
| Compound Name | methyl 2-[5-[N-[[(2,3-dimethylphenyl)-dimethylsilyl]methoxy]-C-methylcarbonimidoyl]-2-methylphenoxy]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 139842992 |
| Molecular Formula | C25H33NO5Si |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | methyl 2-[5-[N-[[(2,3-dimethylphenyl)-dimethylsilyl]methoxy]-C-methylcarbonimidoyl]-2-methylphenoxy]-3-methoxyprop-2-enoate |
| SMILES | COC=C(Oc1cc(C(C)=NOC[Si](C)(C)c2cccc(C)c2C)ccc1C)C(=O)OC |
| InChI | InChI=1S/C25H33NO5Si/c1-17-10-9-11-24(19(17)3)32(7,8)16-30-26-20(4)21-13-12-18(2)22(14-21)31-23(15-28-5)25(27)29-6/h9-15H,16H2,1-8H3 |
| InChIKey | YHYISBTUYBQHGA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|