C19H17ClO7 — CID 70182156
2-[(3-chlorophenyl)methoxy]-6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxybenzoic acid (PubChem CID 70182156) has the molecular formula C19H17ClO7 and a molecular weight of 392.79 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methoxy]-6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxybenzoic acid.
| Compound Name | 2-[(3-chlorophenyl)methoxy]-6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxybenzoic acid |
|---|---|
| PubChem CID | 70182156 |
| Molecular Formula | C19H17ClO7 |
| Molecular Weight | 392.79 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 2-[(3-chlorophenyl)methoxy]-6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxybenzoic acid |
| SMILES | COC=C(Oc1cccc(OCc2cccc(Cl)c2)c1C(=O)O)C(=O)OC |
| InChI | InChI=1S/C19H17ClO7/c1-24-11-16(19(23)25-2)27-15-8-4-7-14(17(15)18(21)22)26-10-12-5-3-6-13(20)9-12/h3-9,11H,10H2,1-2H3,(H,21,22) |
| InChIKey | JPQVXOBZOLPFDD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.79 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|