C23H26O7 — CID 70182211
tert-butyl 2-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxy-6-(phenoxymethyl)benzoate (PubChem CID 70182211) has the molecular formula C23H26O7 and a molecular weight of 414.45 g/mol. Its IUPAC name is tert-butyl 2-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxy-6-(phenoxymethyl)benzoate.
| Compound Name | tert-butyl 2-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxy-6-(phenoxymethyl)benzoate |
|---|---|
| PubChem CID | 70182211 |
| Molecular Formula | C23H26O7 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | tert-butyl 2-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxy-6-(phenoxymethyl)benzoate |
| SMILES | COC=C(Oc1cccc(COc2ccccc2)c1C(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C23H26O7/c1-23(2,3)30-22(25)20-16(14-28-17-11-7-6-8-12-17)10-9-13-18(20)29-19(15-26-4)21(24)27-5/h6-13,15H,14H2,1-5H3 |
| InChIKey | JFWKTNJVMCMPMM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|